C20H24ClNO2 — CID 132652702
4-(4-chlorophenoxy)-N-[1-(3,4-dimethylphenyl)ethyl]butanamide (PubChem CID 132652702) has the molecular formula C20H24ClNO2 and a molecular weight of 345.87 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N-[1-(3,4-dimethylphenyl)ethyl]butanamide.
| Compound Name | 4-(4-chlorophenoxy)-N-[1-(3,4-dimethylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 132652702 |
| Molecular Formula | C20H24ClNO2 |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 4-(4-chlorophenoxy)-N-[1-(3,4-dimethylphenyl)ethyl]butanamide |
| SMILES | Cc1ccc(C(C)NC(=O)CCCOc2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C20H24ClNO2/c1-14-6-7-17(13-15(14)2)16(3)22-20(23)5-4-12-24-19-10-8-18(21)9-11-19/h6-11,13,16H,4-5,12H2,1-3H3,(H,22,23) |
| InChIKey | YPKKMBOWDCJNRJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|