C13H18ClF2N3O2 — CID 119757467
N-(2-acetamido-4,5-difluorophenyl)-4-(methylamino)butanamide;hydrochloride (PubChem CID 119757467) has the molecular formula C13H18ClF2N3O2 and a molecular weight of 321.76 g/mol. Its IUPAC name is N-(2-acetamido-4,5-difluorophenyl)-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-(2-acetamido-4,5-difluorophenyl)-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119757467 |
| Molecular Formula | C13H18ClF2N3O2 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-(2-acetamido-4,5-difluorophenyl)-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)Nc1cc(F)c(F)cc1NC(C)=O.Cl |
| InChI | InChI=1S/C13H17F2N3O2.ClH/c1-8(19)17-11-6-9(14)10(15)7-12(11)18-13(20)4-3-5-16-2;/h6-7,16H,3-5H2,1-2H3,(H,17,19)(H,18,20);1H |
| InChIKey | JUVBBTMVRMQTKP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|