About 2-[[2-(cyclopropylmethylamino)acetyl]amino]-4,5-difluorobenzoic acid
2-[[2-(cyclopropylmethylamino)acetyl]amino]-4,5-difluorobenzoic acid (PubChem CID 62866271) has the molecular formula C13H14F2N2O3
and a molecular weight of 284.26 g/mol. Its IUPAC name is 2-[[2-(cyclopropylmethylamino)acetyl]amino]-4,5-difluorobenzoic acid.
Molecular Properties
| Compound Name | 2-[[2-(cyclopropylmethylamino)acetyl]amino]-4,5-difluorobenzoic acid |
| PubChem CID | 62866271 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-[[2-(cyclopropylmethylamino)acetyl]amino]-4,5-difluorobenzoic acid |
| SMILES | O=C(CNCC1CC1)Nc1cc(F)c(F)cc1C(=O)O |
| InChI | InChI=1S/C13H14F2N2O3/c14-9-3-8(13(19)20)11(4-10(9)15)17-12(18)6-16-5-7-1-2-7/h3-4,7,16H,1-2,5-6H2,(H,17,18)(H,19,20) |
| InChIKey | OUPKRPHTCBMZEU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[2-(cyclopropylmethylamino)acetyl]amino]-4,5-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(cyclopropylmethylamino)acetyl]amino]-4,5-difluorobenzoic acid?
The IUPAC name of 2-[[2-(cyclopropylmethylamino)acetyl]amino]-4,5-difluorobenzoic acid (CID 62866271) is 2-[[2-(cyclopropylmethylamino)acetyl]amino]-4,5-difluorobenzoic acid.
What is the SMILES notation for 2-[[2-(cyclopropylmethylamino)acetyl]amino]-4,5-difluorobenzoic acid?
The canonical SMILES for 2-[[2-(cyclopropylmethylamino)acetyl]amino]-4,5-difluorobenzoic acid is O=C(CNCC1CC1)Nc1cc(F)c(F)cc1C(=O)O.
What is the InChIKey of 2-[[2-(cyclopropylmethylamino)acetyl]amino]-4,5-difluorobenzoic acid?
The InChIKey is OUPKRPHTCBMZEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N2O3/c14-9-3-8(13(19)20)11(4-10(9)15)17-12(18)6-16-5-7-1-2-7/h3-4,7,16H,1-2,5-6H2,(H,17,18)(H,19,20).
What are the key properties of 2-[[2-(cyclopropylmethylamino)acetyl]amino]-4,5-difluorobenzoic acid?
2-[[2-(cyclopropylmethylamino)acetyl]amino]-4,5-difluorobenzoic acid has a molecular weight of 284.26 g/mol, XLogP of 1.60, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(cyclopropylmethylamino)acetyl]amino]-4,5-difluorobenzoic acid is sourced from PubChem (CID 62866271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).