C12H12F2N2O3 — CID 62865922
4,5-difluoro-2-(pyrrolidine-1-carbonylamino)benzoic acid (PubChem CID 62865922) has the molecular formula C12H12F2N2O3 and a molecular weight of 270.23 g/mol. Its IUPAC name is 4,5-difluoro-2-(pyrrolidine-1-carbonylamino)benzoic acid.
| Compound Name | 4,5-difluoro-2-(pyrrolidine-1-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 62865922 |
| Molecular Formula | C12H12F2N2O3 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 4,5-difluoro-2-(pyrrolidine-1-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)cc1NC(=O)N1CCCC1 |
| InChI | InChI=1S/C12H12F2N2O3/c13-8-5-7(11(17)18)10(6-9(8)14)15-12(19)16-3-1-2-4-16/h5-6H,1-4H2,(H,15,19)(H,17,18) |
| InChIKey | QHHPWWMKPPURRT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |