C12H11F3N2O3 — CID 22143302
2-(azetidine-1-carbonylamino)-5-(trifluoromethyl)benzoic acid (PubChem CID 22143302) has the molecular formula C12H11F3N2O3 and a molecular weight of 288.22 g/mol. Its IUPAC name is 2-(azetidine-1-carbonylamino)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(azetidine-1-carbonylamino)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 22143302 |
| Molecular Formula | C12H11F3N2O3 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-(azetidine-1-carbonylamino)-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1cc(C(F)(F)F)ccc1NC(=O)N1CCC1 |
| InChI | InChI=1S/C12H11F3N2O3/c13-12(14,15)7-2-3-9(8(6-7)10(18)19)16-11(20)17-4-1-5-17/h2-3,6H,1,4-5H2,(H,16,20)(H,18,19) |
| InChIKey | VIOZUXSTRMZDTF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |