C13H8F3NO4 — CID 66269172
2-(furan-3-carbonylamino)-5-(trifluoromethyl)benzoic acid (PubChem CID 66269172) has the molecular formula C13H8F3NO4 and a molecular weight of 299.20 g/mol. Its IUPAC name is 2-(furan-3-carbonylamino)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(furan-3-carbonylamino)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 66269172 |
| Molecular Formula | C13H8F3NO4 |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 2-(furan-3-carbonylamino)-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1C(=O)O)c1ccoc1 |
| InChI | InChI=1S/C13H8F3NO4/c14-13(15,16)8-1-2-10(9(5-8)12(19)20)17-11(18)7-3-4-21-6-7/h1-6H,(H,17,18)(H,19,20) |
| InChIKey | UYECAKBBKVNWBB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |