C13H13F3N2O3 — CID 81121037
(3R)-1-[(2,4,5-trifluorophenyl)carbamoyl]piperidine-3-carboxylic acid (PubChem CID 81121037) has the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. Its IUPAC name is (3R)-1-[(2,4,5-trifluorophenyl)carbamoyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[(2,4,5-trifluorophenyl)carbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 81121037 |
| Molecular Formula | C13H13F3N2O3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (3R)-1-[(2,4,5-trifluorophenyl)carbamoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(C(=O)Nc2cc(F)c(F)cc2F)C1 |
| InChI | InChI=1S/C13H13F3N2O3/c14-8-4-10(16)11(5-9(8)15)17-13(21)18-3-1-2-7(6-18)12(19)20/h4-5,7H,1-3,6H2,(H,17,21)(H,19,20)/t7-/m1/s1 |
| InChIKey | HDGLMCMIIMCGTF-SSDOTTSWSA-N |
| XLogP | 2.43 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|