C16H22N2O6 — CID 122087120
1-[(2,4,5-trimethoxyphenyl)carbamoyl]piperidine-3-carboxylic acid (PubChem CID 122087120) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is 1-[(2,4,5-trimethoxyphenyl)carbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(2,4,5-trimethoxyphenyl)carbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122087120 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-[(2,4,5-trimethoxyphenyl)carbamoyl]piperidine-3-carboxylic acid |
| SMILES | COc1cc(OC)c(OC)cc1NC(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C16H22N2O6/c1-22-12-8-14(24-3)13(23-2)7-11(12)17-16(21)18-6-4-5-10(9-18)15(19)20/h7-8,10H,4-6,9H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | VVWRFLYSZVATRM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |