C14H19BrN2O4 — CID 60569756
N-(2-bromo-4,5-dimethoxyphenyl)-3-hydroxypiperidine-1-carboxamide (PubChem CID 60569756) has the molecular formula C14H19BrN2O4 and a molecular weight of 359.22 g/mol. Its IUPAC name is N-(2-bromo-4,5-dimethoxyphenyl)-3-hydroxypiperidine-1-carboxamide.
| Compound Name | N-(2-bromo-4,5-dimethoxyphenyl)-3-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 60569756 |
| Molecular Formula | C14H19BrN2O4 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | N-(2-bromo-4,5-dimethoxyphenyl)-3-hydroxypiperidine-1-carboxamide |
| SMILES | COc1cc(Br)c(NC(=O)N2CCCC(O)C2)cc1OC |
| InChI | InChI=1S/C14H19BrN2O4/c1-20-12-6-10(15)11(7-13(12)21-2)16-14(19)17-5-3-4-9(18)8-17/h6-7,9,18H,3-5,8H2,1-2H3,(H,16,19) |
| InChIKey | CXRHOOGLCLEAQZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |