C14H19BrN2O2 — CID 47223501
N-(4-bromo-2,6-dimethylphenyl)-3-hydroxypiperidine-1-carboxamide (PubChem CID 47223501) has the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-3-hydroxypiperidine-1-carboxamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-3-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 47223501 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-3-hydroxypiperidine-1-carboxamide |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C14H19BrN2O2/c1-9-6-11(15)7-10(2)13(9)16-14(19)17-5-3-4-12(18)8-17/h6-7,12,18H,3-5,8H2,1-2H3,(H,16,19) |
| InChIKey | QQDBPRKYJOBEJX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |