C12H17N3O4 — CID 61405753
2-[2-(dimethylamino)ethylcarbamoylamino]-5-hydroxybenzoic acid (PubChem CID 61405753) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylcarbamoylamino]-5-hydroxybenzoic acid.
| Compound Name | 2-[2-(dimethylamino)ethylcarbamoylamino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 61405753 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-[2-(dimethylamino)ethylcarbamoylamino]-5-hydroxybenzoic acid |
| SMILES | CN(C)CCNC(=O)Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C12H17N3O4/c1-15(2)6-5-13-12(19)14-10-4-3-8(16)7-9(10)11(17)18/h3-4,7,16H,5-6H2,1-2H3,(H,17,18)(H2,13,14,19) |
| InChIKey | XEZRAXDPGZQHLU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|