C13H19N3O4 — CID 62636191
2-[2-[ethyl(methyl)amino]ethylcarbamoylamino]-5-hydroxybenzoic acid (PubChem CID 62636191) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-[2-[ethyl(methyl)amino]ethylcarbamoylamino]-5-hydroxybenzoic acid.
| Compound Name | 2-[2-[ethyl(methyl)amino]ethylcarbamoylamino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 62636191 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-[2-[ethyl(methyl)amino]ethylcarbamoylamino]-5-hydroxybenzoic acid |
| SMILES | CCN(C)CCNC(=O)Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C13H19N3O4/c1-3-16(2)7-6-14-13(20)15-11-5-4-9(17)8-10(11)12(18)19/h4-5,8,17H,3,6-7H2,1-2H3,(H,18,19)(H2,14,15,20) |
| InChIKey | GURJFUAPPPSDAH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|