C13H18BrN3O3 — CID 63113630
3-bromo-2-[2-[ethyl(methyl)amino]ethylcarbamoylamino]benzoic acid (PubChem CID 63113630) has the molecular formula C13H18BrN3O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is 3-bromo-2-[2-[ethyl(methyl)amino]ethylcarbamoylamino]benzoic acid.
| Compound Name | 3-bromo-2-[2-[ethyl(methyl)amino]ethylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 63113630 |
| Molecular Formula | C13H18BrN3O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 3-bromo-2-[2-[ethyl(methyl)amino]ethylcarbamoylamino]benzoic acid |
| SMILES | CCN(C)CCNC(=O)Nc1c(Br)cccc1C(=O)O |
| InChI | InChI=1S/C13H18BrN3O3/c1-3-17(2)8-7-15-13(20)16-11-9(12(18)19)5-4-6-10(11)14/h4-6H,3,7-8H2,1-2H3,(H,18,19)(H2,15,16,20) |
| InChIKey | AIOZQVZJERNOFD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |