C13H15BrN2O3S — CID 106430532
3-bromo-2-(2-prop-2-enylsulfanylethylcarbamoylamino)benzoic acid (PubChem CID 106430532) has the molecular formula C13H15BrN2O3S and a molecular weight of 359.25 g/mol. Its IUPAC name is 3-bromo-2-(2-prop-2-enylsulfanylethylcarbamoylamino)benzoic acid.
| Compound Name | 3-bromo-2-(2-prop-2-enylsulfanylethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 106430532 |
| Molecular Formula | C13H15BrN2O3S |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 3-bromo-2-(2-prop-2-enylsulfanylethylcarbamoylamino)benzoic acid |
| SMILES | C=CCSCCNC(=O)Nc1c(Br)cccc1C(=O)O |
| InChI | InChI=1S/C13H15BrN2O3S/c1-2-7-20-8-6-15-13(19)16-11-9(12(17)18)4-3-5-10(11)14/h2-5H,1,6-8H2,(H,17,18)(H2,15,16,19) |
| InChIKey | GHONKMWGRAXZAQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|