C13H16N2O4S — CID 106430779
2-hydroxy-3-(2-prop-2-enylsulfanylethylcarbamoylamino)benzoic acid (PubChem CID 106430779) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 2-hydroxy-3-(2-prop-2-enylsulfanylethylcarbamoylamino)benzoic acid.
| Compound Name | 2-hydroxy-3-(2-prop-2-enylsulfanylethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 106430779 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-hydroxy-3-(2-prop-2-enylsulfanylethylcarbamoylamino)benzoic acid |
| SMILES | C=CCSCCNC(=O)Nc1cccc(C(=O)O)c1O |
| InChI | InChI=1S/C13H16N2O4S/c1-2-7-20-8-6-14-13(19)15-10-5-3-4-9(11(10)16)12(17)18/h2-5,16H,1,6-8H2,(H,17,18)(H2,14,15,19) |
| InChIKey | YNXOUJUIUPEYMO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|