C13H18N2OS — CID 106430283
2-(methylamino)-N-(2-prop-2-enylsulfanylethyl)benzamide (PubChem CID 106430283) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 2-(methylamino)-N-(2-prop-2-enylsulfanylethyl)benzamide.
| Compound Name | 2-(methylamino)-N-(2-prop-2-enylsulfanylethyl)benzamide |
|---|---|
| PubChem CID | 106430283 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-(methylamino)-N-(2-prop-2-enylsulfanylethyl)benzamide |
| SMILES | C=CCSCCNC(=O)c1ccccc1NC |
| InChI | InChI=1S/C13H18N2OS/c1-3-9-17-10-8-15-13(16)11-6-4-5-7-12(11)14-2/h3-7,14H,1,8-10H2,2H3,(H,15,16) |
| InChIKey | VYZPSZKMURTYPF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|