C10H12BrNO2S — CID 106898564
2-bromo-N-(2-prop-2-enylsulfanylethyl)furan-3-carboxamide (PubChem CID 106898564) has the molecular formula C10H12BrNO2S and a molecular weight of 290.18 g/mol. Its IUPAC name is 2-bromo-N-(2-prop-2-enylsulfanylethyl)furan-3-carboxamide.
| Compound Name | 2-bromo-N-(2-prop-2-enylsulfanylethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106898564 |
| Molecular Formula | C10H12BrNO2S |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | 2-bromo-N-(2-prop-2-enylsulfanylethyl)furan-3-carboxamide |
| SMILES | C=CCSCCNC(=O)c1ccoc1Br |
| InChI | InChI=1S/C10H12BrNO2S/c1-2-6-15-7-4-12-10(13)8-3-5-14-9(8)11/h2-3,5H,1,4,6-7H2,(H,12,13) |
| InChIKey | WDDVXILYMKXZMU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|