C9H11BrN2O3 — CID 106852672
N-(4-amino-4-oxobutyl)-2-bromofuran-3-carboxamide (PubChem CID 106852672) has the molecular formula C9H11BrN2O3 and a molecular weight of 275.10 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-2-bromofuran-3-carboxamide.
| Compound Name | N-(4-amino-4-oxobutyl)-2-bromofuran-3-carboxamide |
|---|---|
| PubChem CID | 106852672 |
| Molecular Formula | C9H11BrN2O3 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-2-bromofuran-3-carboxamide |
| SMILES | NC(=O)CCCNC(=O)c1ccoc1Br |
| InChI | InChI=1S/C9H11BrN2O3/c10-8-6(3-5-15-8)9(14)12-4-1-2-7(11)13/h3,5H,1-2,4H2,(H2,11,13)(H,12,14) |
| InChIKey | QOYYVGCOXAXMKG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|