C10H15BrN2O2 — CID 106855035
2-bromo-N-[3-(ethylamino)propyl]furan-3-carboxamide (PubChem CID 106855035) has the molecular formula C10H15BrN2O2 and a molecular weight of 275.15 g/mol. Its IUPAC name is 2-bromo-N-[3-(ethylamino)propyl]furan-3-carboxamide.
| Compound Name | 2-bromo-N-[3-(ethylamino)propyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 106855035 |
| Molecular Formula | C10H15BrN2O2 |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 2-bromo-N-[3-(ethylamino)propyl]furan-3-carboxamide |
| SMILES | CCNCCCNC(=O)c1ccoc1Br |
| InChI | InChI=1S/C10H15BrN2O2/c1-2-12-5-3-6-13-10(14)8-4-7-15-9(8)11/h4,7,12H,2-3,5-6H2,1H3,(H,13,14) |
| InChIKey | KFDQPXHLJPCSQH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|