C12H16F2N2O — CID 62662463
N-[3-(ethylamino)propyl]-2,3-difluorobenzamide (PubChem CID 62662463) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is N-[3-(ethylamino)propyl]-2,3-difluorobenzamide.
| Compound Name | N-[3-(ethylamino)propyl]-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 62662463 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-[3-(ethylamino)propyl]-2,3-difluorobenzamide |
| SMILES | CCNCCCNC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C12H16F2N2O/c1-2-15-7-4-8-16-12(17)9-5-3-6-10(13)11(9)14/h3,5-6,15H,2,4,7-8H2,1H3,(H,16,17) |
| InChIKey | SDSSNRVRIIYQRB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|