C14H18N4O — CID 104615443
N-[3-(ethylamino)propyl]quinoxaline-5-carboxamide (PubChem CID 104615443) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is N-[3-(ethylamino)propyl]quinoxaline-5-carboxamide.
| Compound Name | N-[3-(ethylamino)propyl]quinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 104615443 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-[3-(ethylamino)propyl]quinoxaline-5-carboxamide |
| SMILES | CCNCCCNC(=O)c1cccc2nccnc12 |
| InChI | InChI=1S/C14H18N4O/c1-2-15-7-4-8-18-14(19)11-5-3-6-12-13(11)17-10-9-16-12/h3,5-6,9-10,15H,2,4,7-8H2,1H3,(H,18,19) |
| InChIKey | SBNPRSLWNLMBLV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|