C12H14N4O3S — CID 74240949
N-[2-(methanesulfonamido)ethyl]quinoxaline-5-carboxamide (PubChem CID 74240949) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)ethyl]quinoxaline-5-carboxamide.
| Compound Name | N-[2-(methanesulfonamido)ethyl]quinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 74240949 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-[2-(methanesulfonamido)ethyl]quinoxaline-5-carboxamide |
| SMILES | CS(=O)(=O)NCCNC(=O)c1cccc2nccnc12 |
| InChI | InChI=1S/C12H14N4O3S/c1-20(18,19)16-8-7-15-12(17)9-3-2-4-10-11(9)14-6-5-13-10/h2-6,16H,7-8H2,1H3,(H,15,17) |
| InChIKey | LBXCOIFDMCUEAE-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|