C11H16N2O5S — CID 43420679
2-hydroxy-N-[2-(methanesulfonamido)ethyl]-3-methoxybenzamide (PubChem CID 43420679) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is 2-hydroxy-N-[2-(methanesulfonamido)ethyl]-3-methoxybenzamide.
| Compound Name | 2-hydroxy-N-[2-(methanesulfonamido)ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 43420679 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-hydroxy-N-[2-(methanesulfonamido)ethyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCNS(C)(=O)=O)c1O |
| InChI | InChI=1S/C11H16N2O5S/c1-18-9-5-3-4-8(10(9)14)11(15)12-6-7-13-19(2,16)17/h3-5,13-14H,6-7H2,1-2H3,(H,12,15) |
| InChIKey | ZGYGAFQSNCCEBS-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|