C14H20N2O4 — CID 61149422
2-hydroxy-3-methoxy-N-[3-oxo-3-(propylamino)propyl]benzamide (PubChem CID 61149422) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-hydroxy-3-methoxy-N-[3-oxo-3-(propylamino)propyl]benzamide.
| Compound Name | 2-hydroxy-3-methoxy-N-[3-oxo-3-(propylamino)propyl]benzamide |
|---|---|
| PubChem CID | 61149422 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-hydroxy-3-methoxy-N-[3-oxo-3-(propylamino)propyl]benzamide |
| SMILES | CCCNC(=O)CCNC(=O)c1cccc(OC)c1O |
| InChI | InChI=1S/C14H20N2O4/c1-3-8-15-12(17)7-9-16-14(19)10-5-4-6-11(20-2)13(10)18/h4-6,18H,3,7-9H2,1-2H3,(H,15,17)(H,16,19) |
| InChIKey | GFPRJCIHVYCIPA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |