C12H15F3N2O2 — CID 43601777
N-[3-(ethylamino)propyl]-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 43601777) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is N-[3-(ethylamino)propyl]-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-[3-(ethylamino)propyl]-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 43601777 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-[3-(ethylamino)propyl]-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | CCNCCCNC(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C12H15F3N2O2/c1-2-16-4-3-5-17-12(19)7-6-8(13)10(15)11(18)9(7)14/h6,16,18H,2-5H2,1H3,(H,17,19) |
| InChIKey | ZNGACHNIUZKQRL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|