C11H14F2N2O — CID 107120407
3-amino-N-butyl-2,5-difluorobenzamide (PubChem CID 107120407) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is 3-amino-N-butyl-2,5-difluorobenzamide.
| Compound Name | 3-amino-N-butyl-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 107120407 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 3-amino-N-butyl-2,5-difluorobenzamide |
| SMILES | CCCCNC(=O)c1cc(F)cc(N)c1F |
| InChI | InChI=1S/C11H14F2N2O/c1-2-3-4-15-11(16)8-5-7(12)6-9(14)10(8)13/h5-6H,2-4,14H2,1H3,(H,15,16) |
| InChIKey | DYIDTHNDOWRPSC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|