C13H19F2N3O — CID 107120916
3-amino-N-[2-(dimethylamino)-2-methylpropyl]-2,5-difluorobenzamide (PubChem CID 107120916) has the molecular formula C13H19F2N3O and a molecular weight of 271.31 g/mol. Its IUPAC name is 3-amino-N-[2-(dimethylamino)-2-methylpropyl]-2,5-difluorobenzamide.
| Compound Name | 3-amino-N-[2-(dimethylamino)-2-methylpropyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 107120916 |
| Molecular Formula | C13H19F2N3O |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 3-amino-N-[2-(dimethylamino)-2-methylpropyl]-2,5-difluorobenzamide |
| SMILES | CN(C)C(C)(C)CNC(=O)c1cc(F)cc(N)c1F |
| InChI | InChI=1S/C13H19F2N3O/c1-13(2,18(3)4)7-17-12(19)9-5-8(14)6-10(16)11(9)15/h5-6H,7,16H2,1-4H3,(H,17,19) |
| InChIKey | IZBCFLIMJMHGIF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|