C13H17F2N3O2 — CID 107121548
3-amino-N-[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]-2,5-difluorobenzamide (PubChem CID 107121548) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is 3-amino-N-[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]-2,5-difluorobenzamide.
| Compound Name | 3-amino-N-[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 107121548 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-amino-N-[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]-2,5-difluorobenzamide |
| SMILES | CCN(C)C(=O)C(C)NC(=O)c1cc(F)cc(N)c1F |
| InChI | InChI=1S/C13H17F2N3O2/c1-4-18(3)13(20)7(2)17-12(19)9-5-8(14)6-10(16)11(9)15/h5-7H,4,16H2,1-3H3,(H,17,19) |
| InChIKey | HOWXVLNXJNBKIQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|