C9H5F3N2O2 — CID 55026463
N-(cyanomethyl)-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 55026463) has the molecular formula C9H5F3N2O2 and a molecular weight of 230.14 g/mol. Its IUPAC name is N-(cyanomethyl)-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-(cyanomethyl)-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 55026463 |
| Molecular Formula | C9H5F3N2O2 |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | N-(cyanomethyl)-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | N#CCNC(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C9H5F3N2O2/c10-5-3-4(9(16)14-2-1-13)6(11)8(15)7(5)12/h3,15H,2H2,(H,14,16) |
| InChIKey | COPPWTWFCVMJNT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|