C11H9F3N2O2 — CID 62651111
N-(2-cyanopropyl)-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 62651111) has the molecular formula C11H9F3N2O2 and a molecular weight of 258.20 g/mol. Its IUPAC name is N-(2-cyanopropyl)-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-(2-cyanopropyl)-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 62651111 |
| Molecular Formula | C11H9F3N2O2 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-(2-cyanopropyl)-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | CC(C#N)CNC(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C11H9F3N2O2/c1-5(3-15)4-16-11(18)6-2-7(12)9(14)10(17)8(6)13/h2,5,17H,4H2,1H3,(H,16,18) |
| InChIKey | MFPHVWXPRKQSKA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|