C11H7F5N2O — CID 55102144
N-(2-cyanopropyl)-2,3,4,5,6-pentafluorobenzamide (PubChem CID 55102144) has the molecular formula C11H7F5N2O and a molecular weight of 278.18 g/mol. Its IUPAC name is N-(2-cyanopropyl)-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-(2-cyanopropyl)-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 55102144 |
| Molecular Formula | C11H7F5N2O |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | N-(2-cyanopropyl)-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CC(C#N)CNC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H7F5N2O/c1-4(2-17)3-18-11(19)5-6(12)8(14)10(16)9(15)7(5)13/h4H,3H2,1H3,(H,18,19) |
| InChIKey | WHIWIYYKXYZGBH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|