C11H12FN3O — CID 107794464
4-amino-N-(2-cyanopropyl)-2-fluorobenzamide (PubChem CID 107794464) has the molecular formula C11H12FN3O and a molecular weight of 221.24 g/mol. Its IUPAC name is 4-amino-N-(2-cyanopropyl)-2-fluorobenzamide.
| Compound Name | 4-amino-N-(2-cyanopropyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 107794464 |
| Molecular Formula | C11H12FN3O |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 4-amino-N-(2-cyanopropyl)-2-fluorobenzamide |
| SMILES | CC(C#N)CNC(=O)c1ccc(N)cc1F |
| InChI | InChI=1S/C11H12FN3O/c1-7(5-13)6-15-11(16)9-3-2-8(14)4-10(9)12/h2-4,7H,6,14H2,1H3,(H,15,16) |
| InChIKey | NRPYPJOUMQZNHM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|