C12H11F3N2O2 — CID 61120957
N-(2-cyanobutan-2-yl)-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 61120957) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is N-(2-cyanobutan-2-yl)-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-(2-cyanobutan-2-yl)-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 61120957 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-(2-cyanobutan-2-yl)-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | CCC(C)(C#N)NC(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C12H11F3N2O2/c1-3-12(2,5-16)17-11(19)6-4-7(13)9(15)10(18)8(6)14/h4,18H,3H2,1-2H3,(H,17,19) |
| InChIKey | KARUHJLMXVRTCU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|