C13H17F3N2O2 — CID 106140043
N-(4-amino-2,2-dimethylbutyl)-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 106140043) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.29 g/mol. Its IUPAC name is N-(4-amino-2,2-dimethylbutyl)-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-(4-amino-2,2-dimethylbutyl)-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 106140043 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-(4-amino-2,2-dimethylbutyl)-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | CC(C)(CCN)CNC(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C13H17F3N2O2/c1-13(2,3-4-17)6-18-12(20)7-5-8(14)10(16)11(19)9(7)15/h5,19H,3-4,6,17H2,1-2H3,(H,18,20) |
| InChIKey | OFPBTUGKYQMHCG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|