C10H13ClF2N2O — CID 119504020
2,3-difluoro-N-[2-(methylamino)ethyl]benzamide;hydrochloride (PubChem CID 119504020) has the molecular formula C10H13ClF2N2O and a molecular weight of 250.68 g/mol. Its IUPAC name is 2,3-difluoro-N-[2-(methylamino)ethyl]benzamide;hydrochloride.
| Compound Name | 2,3-difluoro-N-[2-(methylamino)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119504020 |
| Molecular Formula | C10H13ClF2N2O |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2,3-difluoro-N-[2-(methylamino)ethyl]benzamide;hydrochloride |
| SMILES | CNCCNC(=O)c1cccc(F)c1F.Cl |
| InChI | InChI=1S/C10H12F2N2O.ClH/c1-13-5-6-14-10(15)7-3-2-4-8(11)9(7)12;/h2-4,13H,5-6H2,1H3,(H,14,15);1H |
| InChIKey | IGPLWSHJLVFUKQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|