C10H13ClN2O3 — CID 106812546
N-(5-amino-5-oxopentyl)-2-chlorofuran-3-carboxamide (PubChem CID 106812546) has the molecular formula C10H13ClN2O3 and a molecular weight of 244.68 g/mol. Its IUPAC name is N-(5-amino-5-oxopentyl)-2-chlorofuran-3-carboxamide.
| Compound Name | N-(5-amino-5-oxopentyl)-2-chlorofuran-3-carboxamide |
|---|---|
| PubChem CID | 106812546 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | N-(5-amino-5-oxopentyl)-2-chlorofuran-3-carboxamide |
| SMILES | NC(=O)CCCCNC(=O)c1ccoc1Cl |
| InChI | InChI=1S/C10H13ClN2O3/c11-9-7(4-6-16-9)10(15)13-5-2-1-3-8(12)14/h4,6H,1-3,5H2,(H2,12,14)(H,13,15) |
| InChIKey | HEGQQWRMNRULIO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|