C8H10ClNO2 — CID 106685121
2-chloro-N-propylfuran-3-carboxamide (PubChem CID 106685121) has the molecular formula C8H10ClNO2 and a molecular weight of 187.63 g/mol. Its IUPAC name is 2-chloro-N-propylfuran-3-carboxamide.
| Compound Name | 2-chloro-N-propylfuran-3-carboxamide |
|---|---|
| PubChem CID | 106685121 |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 2-chloro-N-propylfuran-3-carboxamide |
| SMILES | CCCNC(=O)c1ccoc1Cl |
| InChI | InChI=1S/C8H10ClNO2/c1-2-4-10-8(11)6-3-5-12-7(6)9/h3,5H,2,4H2,1H3,(H,10,11) |
| InChIKey | VBXRBUIXSWYEAN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |