C11H16ClNO3 — CID 106687325
2-chloro-N-[2-(2-methylpropoxy)ethyl]furan-3-carboxamide (PubChem CID 106687325) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-methylpropoxy)ethyl]furan-3-carboxamide.
| Compound Name | 2-chloro-N-[2-(2-methylpropoxy)ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 106687325 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2-chloro-N-[2-(2-methylpropoxy)ethyl]furan-3-carboxamide |
| SMILES | CC(C)COCCNC(=O)c1ccoc1Cl |
| InChI | InChI=1S/C11H16ClNO3/c1-8(2)7-15-6-4-13-11(14)9-3-5-16-10(9)12/h3,5,8H,4,6-7H2,1-2H3,(H,13,14) |
| InChIKey | QZCIWWBMNHSIBV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|