C12H15NOS2 — CID 106433477
N-(2-prop-2-enylsulfanylethyl)-3-sulfanylbenzamide (PubChem CID 106433477) has the molecular formula C12H15NOS2 and a molecular weight of 253.39 g/mol. Its IUPAC name is N-(2-prop-2-enylsulfanylethyl)-3-sulfanylbenzamide.
| Compound Name | N-(2-prop-2-enylsulfanylethyl)-3-sulfanylbenzamide |
|---|---|
| PubChem CID | 106433477 |
| Molecular Formula | C12H15NOS2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | N-(2-prop-2-enylsulfanylethyl)-3-sulfanylbenzamide |
| SMILES | C=CCSCCNC(=O)c1cccc(S)c1 |
| InChI | InChI=1S/C12H15NOS2/c1-2-7-16-8-6-13-12(14)10-4-3-5-11(15)9-10/h2-5,9,15H,1,6-8H2,(H,13,14) |
| InChIKey | NIDCQEIUVLUHIL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|