C11H13N3O5 — CID 113458472
2-hydroxy-3-[[2-(methylamino)-2-oxoethyl]carbamoylamino]benzoic acid (PubChem CID 113458472) has the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. Its IUPAC name is 2-hydroxy-3-[[2-(methylamino)-2-oxoethyl]carbamoylamino]benzoic acid.
| Compound Name | 2-hydroxy-3-[[2-(methylamino)-2-oxoethyl]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 113458472 |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-hydroxy-3-[[2-(methylamino)-2-oxoethyl]carbamoylamino]benzoic acid |
| SMILES | CNC(=O)CNC(=O)Nc1cccc(C(=O)O)c1O |
| InChI | InChI=1S/C11H13N3O5/c1-12-8(15)5-13-11(19)14-7-4-2-3-6(9(7)16)10(17)18/h2-4,16H,5H2,1H3,(H,12,15)(H,17,18)(H2,13,14,19) |
| InChIKey | VMGBBMPHVXMUGN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|