C11H12ClN3O4 — CID 63723631
2-chloro-6-[[2-(methylamino)-2-oxoethyl]carbamoylamino]benzoic acid (PubChem CID 63723631) has the molecular formula C11H12ClN3O4 and a molecular weight of 285.69 g/mol. Its IUPAC name is 2-chloro-6-[[2-(methylamino)-2-oxoethyl]carbamoylamino]benzoic acid.
| Compound Name | 2-chloro-6-[[2-(methylamino)-2-oxoethyl]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 63723631 |
| Molecular Formula | C11H12ClN3O4 |
| Molecular Weight | 285.69 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-chloro-6-[[2-(methylamino)-2-oxoethyl]carbamoylamino]benzoic acid |
| SMILES | CNC(=O)CNC(=O)Nc1cccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C11H12ClN3O4/c1-13-8(16)5-14-11(19)15-7-4-2-3-6(12)9(7)10(17)18/h2-4H,5H2,1H3,(H,13,16)(H,17,18)(H2,14,15,19) |
| InChIKey | FVLAGXFOCVIZKA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.69 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |