C14H18ClN3O3 — CID 63722452
2-chloro-6-[3-(cyclopropylamino)propylcarbamoylamino]benzoic acid (PubChem CID 63722452) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is 2-chloro-6-[3-(cyclopropylamino)propylcarbamoylamino]benzoic acid.
| Compound Name | 2-chloro-6-[3-(cyclopropylamino)propylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 63722452 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-chloro-6-[3-(cyclopropylamino)propylcarbamoylamino]benzoic acid |
| SMILES | O=C(NCCCNC1CC1)Nc1cccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C14H18ClN3O3/c15-10-3-1-4-11(12(10)13(19)20)18-14(21)17-8-2-7-16-9-5-6-9/h1,3-4,9,16H,2,5-8H2,(H,19,20)(H2,17,18,21) |
| InChIKey | VOAVGYOBGWUKTJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|