C13H15ClN2O3 — CID 113467374
2-chloro-6-[(3-methylcyclobutyl)carbamoylamino]benzoic acid (PubChem CID 113467374) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is 2-chloro-6-[(3-methylcyclobutyl)carbamoylamino]benzoic acid.
| Compound Name | 2-chloro-6-[(3-methylcyclobutyl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 113467374 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-chloro-6-[(3-methylcyclobutyl)carbamoylamino]benzoic acid |
| SMILES | CC1CC(NC(=O)Nc2cccc(Cl)c2C(=O)O)C1 |
| InChI | InChI=1S/C13H15ClN2O3/c1-7-5-8(6-7)15-13(19)16-10-4-2-3-9(14)11(10)12(17)18/h2-4,7-8H,5-6H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | ZMQYMBDABSYWDQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |