C13H15ClN2O3 — CID 63724321
2-chloro-6-[[cyclopropylmethyl(methyl)carbamoyl]amino]benzoic acid (PubChem CID 63724321) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is 2-chloro-6-[[cyclopropylmethyl(methyl)carbamoyl]amino]benzoic acid.
| Compound Name | 2-chloro-6-[[cyclopropylmethyl(methyl)carbamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 63724321 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-chloro-6-[[cyclopropylmethyl(methyl)carbamoyl]amino]benzoic acid |
| SMILES | CN(CC1CC1)C(=O)Nc1cccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C13H15ClN2O3/c1-16(7-8-5-6-8)13(19)15-10-4-2-3-9(14)11(10)12(17)18/h2-4,8H,5-7H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | XCFNPNYVUCPQDD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |