C12H15ClN2O4 — CID 104553093
2-chloro-6-[[1-hydroxypropan-2-yl(methyl)carbamoyl]amino]benzoic acid (PubChem CID 104553093) has the molecular formula C12H15ClN2O4 and a molecular weight of 286.71 g/mol. Its IUPAC name is 2-chloro-6-[[1-hydroxypropan-2-yl(methyl)carbamoyl]amino]benzoic acid.
| Compound Name | 2-chloro-6-[[1-hydroxypropan-2-yl(methyl)carbamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 104553093 |
| Molecular Formula | C12H15ClN2O4 |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-chloro-6-[[1-hydroxypropan-2-yl(methyl)carbamoyl]amino]benzoic acid |
| SMILES | CC(CO)N(C)C(=O)Nc1cccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C12H15ClN2O4/c1-7(6-16)15(2)12(19)14-9-5-3-4-8(13)10(9)11(17)18/h3-5,7,16H,6H2,1-2H3,(H,14,19)(H,17,18) |
| InChIKey | DVXKZZNIUDGOMG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |