C12H15BrClN3O2 — CID 99834298
N-[3-[(2-bromo-3-chlorophenyl)carbamoylamino]propyl]acetamide (PubChem CID 99834298) has the molecular formula C12H15BrClN3O2 and a molecular weight of 348.63 g/mol. Its IUPAC name is N-[3-[(2-bromo-3-chlorophenyl)carbamoylamino]propyl]acetamide.
| Compound Name | N-[3-[(2-bromo-3-chlorophenyl)carbamoylamino]propyl]acetamide |
|---|---|
| PubChem CID | 99834298 |
| Molecular Formula | C12H15BrClN3O2 |
| Molecular Weight | 348.63 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | N-[3-[(2-bromo-3-chlorophenyl)carbamoylamino]propyl]acetamide |
| SMILES | CC(=O)NCCCNC(=O)Nc1cccc(Cl)c1Br |
| InChI | InChI=1S/C12H15BrClN3O2/c1-8(18)15-6-3-7-16-12(19)17-10-5-2-4-9(14)11(10)13/h2,4-5H,3,6-7H2,1H3,(H,15,18)(H2,16,17,19) |
| InChIKey | FGBKUECCLVUIDN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.63 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|