C11H14ClN3O2 — CID 47103341
N-[2-[(2-chlorophenyl)carbamoylamino]ethyl]acetamide (PubChem CID 47103341) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.71 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)carbamoylamino]ethyl]acetamide.
| Compound Name | N-[2-[(2-chlorophenyl)carbamoylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 47103341 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-[2-[(2-chlorophenyl)carbamoylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C11H14ClN3O2/c1-8(16)13-6-7-14-11(17)15-10-5-3-2-4-9(10)12/h2-5H,6-7H2,1H3,(H,13,16)(H2,14,15,17) |
| InChIKey | KGJMFAWBYWQYHY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|