C16H14Cl3N3O2 — CID 78871648
3,4-dichloro-N-[2-[(2-chlorophenyl)carbamoylamino]ethyl]benzamide (PubChem CID 78871648) has the molecular formula C16H14Cl3N3O2 and a molecular weight of 386.67 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[(2-chlorophenyl)carbamoylamino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[(2-chlorophenyl)carbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 78871648 |
| Molecular Formula | C16H14Cl3N3O2 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 3,4-dichloro-N-[2-[(2-chlorophenyl)carbamoylamino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccc(Cl)c(Cl)c1)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H14Cl3N3O2/c17-11-6-5-10(9-13(11)19)15(23)20-7-8-21-16(24)22-14-4-2-1-3-12(14)18/h1-6,9H,7-8H2,(H,20,23)(H2,21,22,24) |
| InChIKey | XACKMRVDEBQADO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|