C15H12Cl3NO2 — CID 113099351
3,4-dichloro-N-[2-(2-chlorophenoxy)ethyl]benzamide (PubChem CID 113099351) has the molecular formula C15H12Cl3NO2 and a molecular weight of 344.63 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(2-chlorophenoxy)ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(2-chlorophenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 113099351 |
| Molecular Formula | C15H12Cl3NO2 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 3,4-dichloro-N-[2-(2-chlorophenoxy)ethyl]benzamide |
| SMILES | O=C(NCCOc1ccccc1Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl3NO2/c16-11-6-5-10(9-13(11)18)15(20)19-7-8-21-14-4-2-1-3-12(14)17/h1-6,9H,7-8H2,(H,19,20) |
| InChIKey | UOIZRPWRWAIUBI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|