C16H16ClN3O6 — CID 158874069
N-[2-(2-chlorophenoxy)ethyl]-3,5-dinitrobenzamide;methane (PubChem CID 158874069) has the molecular formula C16H16ClN3O6 and a molecular weight of 381.77 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)ethyl]-3,5-dinitrobenzamide;methane.
| Compound Name | N-[2-(2-chlorophenoxy)ethyl]-3,5-dinitrobenzamide;methane |
|---|---|
| PubChem CID | 158874069 |
| Molecular Formula | C16H16ClN3O6 |
| Molecular Weight | 381.77 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | N-[2-(2-chlorophenoxy)ethyl]-3,5-dinitrobenzamide;methane |
| SMILES | C.O=C(NCCOc1ccccc1Cl)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12ClN3O6.CH4/c16-13-3-1-2-4-14(13)25-6-5-17-15(20)10-7-11(18(21)22)9-12(8-10)19(23)24;/h1-4,7-9H,5-6H2,(H,17,20);1H4 |
| InChIKey | JCFFFLAUSILEFW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.77 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|